
CAS 317821-73-1
:Hydroxylamine, O-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:1)
Description:
Hydroxylamine, O-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its hydroxylamine functional group, which is known for its reactivity, particularly in organic synthesis and as a reducing agent. The presence of the 3-chloro-2-fluorophenyl group indicates that this compound has both halogen substituents, which can influence its chemical behavior and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the hydroxylamine moiety, which can participate in various chemical reactions, including nucleophilic attacks and the formation of oximes. Safety data should be consulted, as compounds containing halogens and nitrogen can pose health risks, including toxicity and environmental hazards. Proper handling and storage conditions are essential to ensure safety when working with this substance.
Formula:C7H7ClFNO·ClH
InChI:InChI=1S/C7H7ClFNO.ClH/c8-6-3-1-2-5(4-11-10)7(6)9;/h1-3H,4,10H2;1H
InChI key:InChIKey=OTUWOCOWJLWXPI-UHFFFAOYSA-N
SMILES:C(ON)C1=C(F)C(Cl)=CC=C1.Cl
Synonyms:- Hydroxylamine, O-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride (1:1)
- Hydroxylamine, O-[(3-chloro-2-fluorophenyl)methyl]-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
O-[(3-Chloro-2-fluorophenyl)methyl]hydroxylamine hydrochloride
CAS:O-[(3-Chloro-2-fluorophenyl)methyl]hydroxylamine hydrochloridePurity:techMolecular weight:212.05g/mol
