CAS 31784-70-0

thiazolo[5,4-b]pyridin-2-amine

Description:

Thiazolo[5,4-b]pyridin-2-amine is a heterocyclic compound characterized by a fused thiazole and pyridine ring system. This compound features a thiazole ring, which contains both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of an amino group at the 2-position of the pyridine ring enhances its reactivity and potential for forming hydrogen bonds, making it a candidate for various biological activities. Thiazolo[5,4-b]pyridin-2-amine is often explored in medicinal chemistry for its potential as a pharmacophore in drug development, particularly in the search for compounds with antimicrobial, anti-inflammatory, or anticancer properties. Its structural features allow for diverse interactions with biological targets, and it may exhibit solubility in polar solvents. The compound's stability and reactivity can be influenced by substituents on the rings, making it a versatile scaffold for further chemical modifications. Overall, thiazolo[5,4-b]pyridin-2-amine represents an interesting class of compounds in the field of organic and medicinal chemistry.

Formula: C₆H₅N₃S

InChI: InChI=1/C6H5N3S/c7-6-9-4-2-1-3-8-5(4)10-6/h1-3H,(H2,7,9)

SMILES: c1cc2c(nc1)sc(=N)[nH]2

Synonyms:

• [1,3]Thiazolo[5,4-b]pyridin-2-amine
• Thiazolo[5,4-b]pyridin-2-amine

Thiazolo[5,4-b]pyridin-2-amine

CAS: 31784-70-0

Formula: C₆H₅N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.1890

Ref: IN-DA007IG4

Thiazolo[5,4-b]pyridin-2-amine

CAS: 31784-70-0

Thiazolo[5,4-b]pyridin-2-amine

Purity: 98%

Ref: 54-OR1041619

2-Aminothiazolo[5,4-b]pyridine

CAS: 31784-70-0

Formula: C₆H₅N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.19

Ref: 10-F036683

2-Aminothiazolo[5,4-b]pyridine

CAS: 31784-70-0

2-Aminothiazolo[5,4-b]pyridine is an isothiocyanate that has potent antiproliferative and anticancer effects. It causes the inhibition of tumor growth by inhibiting the activity of enzymes such as DNA polymerase or topoisomerase II. 2-Aminothiazolo[5,4-b]pyridine also inhibits the proliferation of cancer cells and induces apoptosis. The anticancer effects are due to its ability to inhibit tumor cell growth and induce apoptosis in cancer cells.

Formula: C₆H₅N₃S

Purity: Min. 95%

Molecular weight: 151.19 g/mol

Ref: 3D-GBA78470