CAS 31785-60-1

2,3-Dihydro-2-(1-naphthalenyl)-4(1H)-quinazolinone

Description:

2,3-Dihydro-2-(1-naphthalenyl)-4(1H)-quinazolinone, with the CAS number 31785-60-1, is a chemical compound that belongs to the quinazolinone class of heterocyclic compounds. It features a fused bicyclic structure that includes a quinazolinone moiety and a naphthalene substituent, contributing to its unique chemical properties. This compound is characterized by its potential biological activity, which may include antimicrobial, anti-inflammatory, or anticancer properties, although specific biological effects can vary based on structural modifications and experimental conditions. The presence of the naphthyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the compound may exhibit various physical properties such as solubility in organic solvents and stability under certain conditions. Its synthesis typically involves multi-step organic reactions, and it may serve as a valuable intermediate in the development of pharmaceuticals or agrochemicals. As with many quinazolinone derivatives, it is of interest in medicinal chemistry for its potential therapeutic applications.

Formula: C₁₈H₁₄N₂O

InChI: InChI=1S/C18H14N2O/c21-18-15-9-3-4-11-16(15)19-17(20-18)14-10-5-7-12-6-1-2-8-13(12)14/h1-11,17,19H,(H,20,21)

InChI key: InChIKey=XKEIBCWTOUEGSH-UHFFFAOYSA-N

SMILES: O=C1NC(C=2C3=C(C=CC2)C=CC=C3)NC=4C1=CC=CC4

Synonyms:

• NSC 145669
• 4(1H)-Quinazolinone, 2,3-dihydro-2-(1-naphthalenyl)-
• 4(1H)-Quinazolinone, 2,3-dihydro-2-(1-naphthyl)-
• 2,3-Dihydro-2-(1-naphthyl)-4(1H)-quinazolinone
• 2,3-Dihydro-2-(1-naphthalenyl)-4(1H)-quinazolinone

DHNQ

CAS: 31785-60-1

DHNQ is a novel inhibitor of the PI3K enzyme activity and transcriptional as well as translational expression levels in colorectal cancer (CRC).

Formula: C₁₈H₁₄N₂O

Color and Shape: Solid

Molecular weight: 274.32

Ref: TM-T27163