CAS 31786-18-2

1,2,3,4-tetrahydro-2,6-naphthyridine

Description:

1,2,3,4-Tetrahydro-2,6-naphthyridine is a bicyclic organic compound characterized by its fused ring structure, which includes a nitrogen atom in the naphthyridine framework. This compound features a saturated tetrahydro configuration, indicating that it has four hydrogen atoms added to the naphthyridine structure, resulting in a more stable, saturated form. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the nitrogen atom contributes to its basicity and potential reactivity, making it of interest in medicinal chemistry and organic synthesis. Its molecular structure allows for various functional group modifications, which can enhance its biological activity or solubility. Additionally, 1,2,3,4-tetrahydro-2,6-naphthyridine may exhibit properties such as moderate polarity and the ability to participate in hydrogen bonding, influencing its interactions in biological systems. As with many nitrogen-containing heterocycles, it may also display pharmacological properties, making it a subject of research in drug development.

Formula: C₈H₁₀N₂

InChI: InChI=1/C8H10N2/c1-3-9-6-8-2-4-10-5-7(1)8/h1,3,6,10H,2,4-5H2

SMILES: c1cncc2CCNCc12

Synonyms:

• 2,6-Naphthyridine, 1,2,3,4-Tetrahydro-
• 1,2,3,4-Tetrahydro-2,6-naphthyridine

1,2,3,4-Tetrahydro-2,6-naphthyridine

CAS: 31786-18-2

Formula: C₈H₁₀N₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 134.1784

Ref: IN-DA00382M

1,2,3,4-Tetrahydro-2,6-naphthyridine

CAS: 31786-18-2

1,2,3,4-Tetrahydro-2,6-naphthyridine

Purity: 96%

Molecular weight: 134.18g/mol

Ref: 54-OR86244

1,2,3,4-Tetrahydro-2,6-naphthyridine

CAS: 31786-18-2

Formula: C₈H₁₀N₂

Purity: 96%

Molecular weight: 134.182

Ref: 10-F093621

1,2,3,4-Tetrahydro-2,6-naphthyridine

Controlled Product

CAS: 31786-18-2

Formula: C₈H₁₀N₂

Color and Shape: Neat

Molecular weight: 134.178

Ref: TR-T295698

1,2,3,4-Tetrahydro-2,6-naphthyridine

CAS: 31786-18-2

1,2,3,4-Tetrahydro-2,6-naphthyridine is a metalated naphthyridine. It is an inhibitor of the transporter and reuptake transporter of histamine and serotonin. The compound has been shown to bind to the transporter site of neurotransmitters such as serotonin and histamine. This binding blocks the uptake and release of neurotransmitters from nerve cells, preventing the transmission of nerve impulses.

Formula: C₈H₁₀N₂

Purity: Min. 95%

Molecular weight: 134.18 g/mol

Ref: 3D-FT155829