CAS 31788-83-7

1-phenyl-2-pyrrolidin-1-ylethanamine

Description:

1-Phenyl-2-pyrrolidin-1-ylethanamine, also known by its CAS number 31788-83-7, is a chemical compound that belongs to the class of substituted phenethylamines. It features a phenyl group attached to a pyrrolidine ring, which is further connected to an ethylamine moiety. This structure contributes to its potential psychoactive properties, making it of interest in both medicinal chemistry and research contexts. The compound is typically characterized by its ability to interact with various neurotransmitter systems, particularly those involving dopamine and serotonin, which may influence mood and cognitive functions. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many compounds in this class, safety and regulatory considerations are paramount, given the potential for abuse and the need for careful handling in laboratory settings. Overall, 1-phenyl-2-pyrrolidin-1-ylethanamine exemplifies the complexity and diversity of organic compounds with implications in pharmacology and neuroscience.

Formula: C₁₂H₁₈N₂

InChI: InChI=1/C12H18N2/c13-12(10-14-8-4-5-9-14)11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,13H2

SMILES: c1ccc(cc1)C(CN1CCCC1)N

Synonyms:

• 1-Phenyl-2-(pyrrolidin-1-yl)ethanamine
• 1-Pyrrolidineethanamine, alpha-phenyl-

1-phenyl-2-(pyrrolidin-1-yl)ethan-1-amine

CAS: 31788-83-7

Formula: C₁₂H₁₈N₂

Molecular weight: 190.2847

Ref: IN-DA00BZ32

1-Phenyl-2-pyrrolidin-1-ylethylamine

CAS: 31788-83-7

1-Phenyl-2-pyrrolidin-1-ylethylamine

Purity: ≥95%

Molecular weight: 190.28g/mol

Ref: 54-OR12711

1-Phenyl-2-(pyrrolidin-1-yl)ethan-1-amine

CAS: 31788-83-7

Versatile small molecule scaffold

Formula: C₁₂H₁₈N₂

Purity: Min. 95%

Molecular weight: 190.28 g/mol

Ref: 3D-GBA78883