
CAS 318-23-0
:Imolamine
Description:
Imolamine, with the CAS number 318-23-0, is a chemical compound that belongs to the class of amines. It is characterized by its structure, which typically includes an amino group (-NH2) attached to a hydrocarbon chain. Imolamine is known for its role as a surfactant and emulsifying agent, often utilized in various industrial applications, including cosmetics and personal care products. The compound exhibits properties such as solubility in water and the ability to interact with both polar and non-polar substances, making it effective in stabilizing emulsions. Additionally, imolamine may possess mild antimicrobial properties, contributing to its use in formulations aimed at preserving product integrity. Safety data indicates that, like many amines, it should be handled with care to avoid skin and eye irritation. Overall, imolamine's unique chemical characteristics make it a valuable ingredient in multiple formulations across different industries.
Formula:C14H20N4O
InChI:InChI=1S/C14H20N4O/c1-3-17(4-2)10-11-18-13(16-19-14(18)15)12-8-6-5-7-9-12/h5-9,15H,3-4,10-11H2,1-2H3
InChI key:InChIKey=MGSPDRWOUCPKNZ-UHFFFAOYSA-N
SMILES:C(CN(CC)CC)N1C(=NOC1=N)C2=CC=CC=C2
Synonyms:- 4-[2-(Diethylamino)ethyl]-5-imino-3-phenyl-Δ2-1,2,4-oxadiazoline
- Δ2-1,2,4-Oxadiazoline, 4-[2-(diethylamino)ethyl]-5-imino-3-phenyl-
- Imolamine
- N,N-Diethyl-5-imino-3-phenyl-1,2,4-oxadiazole-4(5H)-ethanamine
- 1,2,4-Oxadiazole-4(5H)-ethanamine, N,N-diethyl-5-imino-3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
