
CAS 318-99-0
:N-(2,2-Difluoroethyl)-1-naphthalenamine
Description:
N-(2,2-Difluoroethyl)-1-naphthalenamine, with the CAS number 318-99-0, is an organic compound characterized by its naphthalene backbone substituted with an amino group and a difluoroethyl side chain. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring, which contributes to its stability and potential reactivity. The difluoroethyl group introduces unique electronic and steric effects, which can influence the compound's chemical behavior, including its reactivity in nucleophilic substitution reactions. Additionally, the presence of fluorine atoms can enhance lipophilicity and alter the compound's solubility in various solvents. N-(2,2-Difluoroethyl)-1-naphthalenamine may have applications in pharmaceuticals, agrochemicals, or materials science, where its specific properties can be utilized. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C12H11F2N
InChI:InChI=1S/C12H11F2N/c13-12(14)8-15-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12,15H,8H2
InChI key:InChIKey=OCMONQGCMFBZIS-UHFFFAOYSA-N
SMILES:N(CC(F)F)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- N-(2,2-Difluoroethyl)-1-naphthalenamine
- 1-Naphthalenamine, N-(2,2-difluoroethyl)-
- 1-Naphthylamine, N-(2,2-difluoroethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery