CAS 3180-78-7
:1-hexopyranosyl-5-methylpyrimidine-2,4(1H,3H)-dione
Description:
1-Hexopyranosyl-5-methylpyrimidine-2,4(1H,3H)-dione, with the CAS number 3180-78-7, is a chemical compound that features a pyrimidine ring substituted with a hexopyranosyl group and a methyl group. This compound is characterized by its heterocyclic structure, which includes both nitrogen and oxygen atoms, contributing to its potential biological activity. The presence of the hexopyranosyl moiety suggests that it may exhibit properties related to carbohydrate chemistry, possibly influencing its solubility and reactivity. The methyl group on the pyrimidine ring can affect the compound's electronic properties and steric hindrance, which may play a role in its interactions with biological targets. Additionally, the diketone functionality (2,4-dione) indicates that it may participate in various chemical reactions, such as tautomerization or condensation. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals or as a biochemical probe.
Formula:C11H16N2O7
InChI:InChI=1/C11H16N2O7/c1-4-2-13(11(19)12-9(4)18)10-8(17)7(16)6(15)5(3-14)20-10/h2,5-8,10,14-17H,3H2,1H3,(H,12,18,19)
SMILES:Cc1cn(C2C(C(C(C(CO)O2)O)O)O)c(=O)nc1O
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 1-hexopyranosyl-5-methyl-
- 1-(a-D-Mannopyranosyl)thymine
- 1-(β-D-Glucopyranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 1-β-D-glucopyranosyl-5-methyl-
- 1-(β-D-Glucopyranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(a-D-Mannopyranosyl)thymine
CAS:<p>1-(a-D-Mannopyranosyl)thymine is a phosphoramidite nucleoside with antiviral activity. It is an analog of thymine, in which the oxygen atom at the 5-position has been replaced by a mannose group and the hydroxyl group at the 4-position has been replaced by a methyl group. This compound has shown to have anticancer properties as well as inhibitory effects on HIV replication. Studies have also shown that 1-(a-D-mannopyranosyl)thymine inhibits proliferation and induces apoptosis in human cancer cell lines.</p>Formula:C11H16N2O7Purity:Min. 95%Color and Shape:Light (Or Pale) Yellow SolidMolecular weight:288.75 g/mol
