CAS 31814-59-2

5,8-Diethyl-7-hydroxy-6-dodecanone

Description:

5,8-Diethyl-7-hydroxy-6-dodecanone, with the CAS number 31814-59-2, is an organic compound characterized by its long carbon chain and functional groups. This molecule features a dodecanone backbone, indicating it is a ketone with a 12-carbon chain, which contributes to its hydrophobic properties. The presence of two ethyl groups at the 5 and 8 positions enhances its hydrophobic character and may influence its solubility in organic solvents. The hydroxyl group at the 7 position introduces polarity, allowing for potential hydrogen bonding, which can affect its reactivity and interactions with other substances. This compound may exhibit interesting biological activities due to its structural features, making it of interest in fields such as medicinal chemistry or fragrance formulation. Its physical properties, such as boiling point, melting point, and solubility, would be influenced by the balance between its hydrophobic and hydrophilic characteristics. Overall, 5,8-Diethyl-7-hydroxy-6-dodecanone is a complex molecule with potential applications in various chemical and industrial processes.

Formula: C₁₆H₃₂O₂

InChI: InChI=1S/C16H32O2/c1-5-9-11-13(7-3)15(17)16(18)14(8-4)12-10-6-2/h13-15,17H,5-12H2,1-4H3

InChI key: InChIKey=RCEAKQYSPGVKEX-UHFFFAOYSA-N

SMILES: C(C(C(C(CCCC)CC)=O)O)(CCCC)CC

Synonyms:

• 5,8-Diethyl-7-hydroxy-6-dodecanone
• 6-Dodecanone, 5,8-diethyl-7-hydroxy-