CAS 31823-05-9

1-benzofuran-5-ylmethanol

Description:

1-Benzofuran-5-ylmethanol, with the CAS number 31823-05-9, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a hydroxymethyl group (-CH2OH) attached to the benzofuran at the 5-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxymethyl group makes it a potential candidate for further chemical modifications, such as oxidation or substitution reactions. 1-Benzofuran-5-ylmethanol may exhibit interesting biological activities, making it of interest in medicinal chemistry and pharmacology. Its solubility in organic solvents and moderate polarity can influence its behavior in various chemical environments. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₉H₈O₂

InChI: InChI=1/C9H8O2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,10H,6H2

SMILES: c1cc2c(cco2)cc1CO

Synonyms:

• 5-Benzofuranmethanol
• 1-BENZOFURAN-5-YLMETHANOL
• RARECHEM AL BD 1369
• Benzofuran-5-yl-Methanol

1-Benzofuran-5-ylmethanol

CAS: 31823-05-9

Formula: C₉H₈O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 148.1586

Ref: IN-DA00C0DW

Benzofuran-5-ylmethanol

CAS: 31823-05-9

Benzofuran-5-ylmethanol

Purity: 98%

Color and Shape: Solid

Molecular weight: 148.15862g/mol

Ref: 54-OR111567

Benzofuran-5-ylmethanol

CAS: 31823-05-9

Purity: 97%

Molecular weight: 148.1609955

Ref: 10-F618545

1-Benzofuran-5-ylmethanol

Controlled Product

CAS: 31823-05-9

Formula: C₉H₈O₂

Color and Shape: Neat

Molecular weight: 148.159

Ref: TR-B426063

Benzofuran-5-ylmethanol

CAS: 31823-05-9

Benzofuran-5-ylmethanol is an aromatic ether that finds applications in various industries such as research chemicals, medicines, and catalysts. It is used as a building block for the synthesis of compounds like oxalyl glycine, aldehyde dimers, and trifluoroacetic acid. Benzofuran-5-ylmethanol also exhibits antiviral properties and has been studied for its potential in inhibiting viral replication. Additionally, it is a precursor for the synthesis of phenylethylamine derivatives and polyunsaturated fatty acids. With its diverse range of applications, Benzofuran-5-ylmethanol serves as a valuable compound in the field of organic chemistry and industrial processes.

Formula: C₉H₈O₂

Purity: Min. 95%

Molecular weight: 148.16 g/mol

Ref: 3D-GBA82305