CAS 318234-44-5
:2-Phenyl-5-(1H-pyrazol-3-yl)thiazole
Description:
2-Phenyl-5-(1H-pyrazol-3-yl)thiazole is an organic compound characterized by its unique structural features, which include a thiazole ring fused with a phenyl group and a pyrazole moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The thiazole ring contributes to its heterocyclic nature, while the phenyl and pyrazole groups can enhance its lipophilicity and potential interactions with biological targets. The presence of nitrogen and sulfur atoms in the thiazole structure often imparts specific reactivity and stability characteristics. Additionally, compounds like this may exhibit fluorescence properties, which can be useful in various analytical applications. Its synthesis generally involves multi-step organic reactions, and it may be evaluated for its pharmacological properties, including anti-inflammatory, antimicrobial, or anticancer activities. As with many heterocyclic compounds, the specific interactions and effects can vary based on the substituents and the overall molecular configuration.
Formula:C12H9N3S
InChI:InChI=1S/C12H9N3S/c1-2-4-9(5-3-1)12-13-8-11(16-12)10-6-7-14-15-10/h1-8H,(H,14,15)
InChI key:InChIKey=NRAHRUHGPGBWSI-UHFFFAOYSA-N
SMILES:C=1(SC(=NC1)C2=CC=CC=C2)C=3C=CNN3
Synonyms:- 2-Phenyl-5-(1H-pyrazol-3-yl)thiazole
- Thiazole, 2-phenyl-5-(1H-pyrazol-3-yl)-
- 2-Phenyl-5-(1H-pyrazol-5-yl)-1,3-thiazole
- 2-Phenyl-5-(1H-Pyrazol-3-Yl)-1,3-Thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.