CymitQuimica logo

CAS 31825-95-3

:

2-Methyl-4-thiazolecarboxamide

Description:
2-Methyl-4-thiazolecarboxamide, with the CAS number 31825-95-3, is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen. This compound features a carboxamide functional group, contributing to its polar nature and potential solubility in polar solvents. It typically appears as a crystalline solid and is known for its biological activity, often studied for its potential applications in pharmaceuticals and agrochemicals. The presence of the methyl group at the second position of the thiazole ring can influence its reactivity and interaction with biological targets. Additionally, 2-Methyl-4-thiazolecarboxamide may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its stability, reactivity, and specific interactions depend on the surrounding conditions, including pH and temperature. Overall, this compound represents a significant class of thiazole derivatives with diverse applications in various fields of chemistry and biology.
Formula:C5H6N2OS
InChI:InChI=1/C5H6N2OS/c1-3-7-4(2-9-3)5(6)8/h2H,1H3,(H2,6,8)
InChI key:InChIKey=JFBXSNFENTXBSX-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C(C)SC1
Synonyms:
  • 2-Methyl-1,3-thiazole-4-carboxamide
  • 4-Thiazolecarboxamide,2-methyl-
  • 2-Methyl-4-thiazolecarboxamide
  • 2-Methyl-1,3-thiazole-4-carboxylic acid amide
  • 2-Methyl-1,3-oxazole-4-carboamide
Found 3 products.