CymitQuimica logo

CAS 31827-94-8

:

2-Bromo-4'-iodoacetophenone

Description:
2-Bromo-4'-iodoacetophenone is an organic compound characterized by its aromatic structure, featuring a bromine atom and an iodine atom substituted on the phenyl ring of an acetophenone moiety. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of both halogen substituents, which can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the acetophenone functional group indicates that it has a carbonyl (C=O) group, contributing to its potential use in organic synthesis and medicinal chemistry. The compound is often utilized in research and development for the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C8H6BrIO
InChI:InChI=1/C8H6BrIO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2
InChI key:FSIBMLJFLPWMTD-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)CBr)I
Synonyms:
  • 2-Bromo-1-(4-iodophenyl)ethanone
Found 4 products.