
CAS 318288-80-1
:Hydroxylamine, O-[(5-chloro-1,2,3-thiadiazol-4-yl)methyl]-, hydrochloride (1:1)
Description:
Hydroxylamine, O-[(5-chloro-1,2,3-thiadiazol-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a hydroxylamine functional group and a thiadiazole moiety. The presence of the 5-chloro-1,2,3-thiadiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications. The compound may exhibit properties such as being a reducing agent, and it could participate in nucleophilic substitution reactions due to the presence of the hydroxylamine group. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the purity and form of the compound. Safety data should be consulted, as compounds containing chlorinated heterocycles can pose health risks. Overall, this compound represents a blend of organic and inorganic chemistry, with potential applications in medicinal chemistry and agrochemicals.
Formula:C3H4ClN3OS·ClH
InChI:InChI=1S/C3H4ClN3OS.ClH/c4-3-2(1-8-5)6-7-9-3;/h1,5H2;1H
InChI key:InChIKey=RIGDHOFDYPQFLT-UHFFFAOYSA-N
SMILES:C(ON)C1=C(Cl)SN=N1.Cl
Synonyms:- Hydroxylamine, O-[(5-chloro-1,2,3-thiadiazol-4-yl)methyl]-, hydrochloride (1:1)
- 1,2,3-Thiadiazole, 4-[(aminooxy)methyl]-5-chloro-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.