CAS 318290-98-1
:Fluensulfone
Description:
Fluensulfone is a synthetic chemical compound classified as a sulfone, primarily used as a pesticide and nematicide in agricultural applications. It is characterized by its ability to control a variety of soil-borne pests, particularly nematodes, making it valuable in crop protection. The compound exhibits a unique mode of action that disrupts the nervous system of target organisms, leading to their mortality. Fluensulfone is typically applied in soil treatments and has shown effectiveness in various crops. It is known for its relatively low toxicity to non-target organisms, including beneficial insects and mammals, which makes it an environmentally favorable option compared to traditional nematicides. Additionally, fluensulfone is stable under a range of environmental conditions, contributing to its efficacy in agricultural settings. However, as with all pesticides, it is essential to follow regulatory guidelines and safety measures during its application to minimize potential risks to human health and the environment.
Formula:C7H5ClF3NO2S2
InChI:InChI=1S/C7H5ClF3NO2S2/c8-5-3-12-7(15-5)16(13,14)2-1-4(9)6(10)11/h3H,1-2H2
InChI key:InChIKey=XSNMWAPKHUGZGQ-UHFFFAOYSA-N
SMILES:S(CCC(=C(F)F)F)(=O)(=O)C1=NC=C(Cl)S1
Synonyms:- 318290-98-1
- 5-Chloro-2-[(3,4,4-trifluoro-3-buten-1-yl)sulfonyl]thiazole
- Fluensulfone
- Fluvathiide
- Mcw 2
- Nimitz
- Nimitz 480EC
- T5N Csj Bsw2Yfuyff Dg
- Thiazole, 5-chloro-2-[(3,4,4-trifluoro-3-buten-1-yl)sulfonyl]-
- Thiazole, 5-chloro-2-[(3,4,4-trifluoro-3-butenyl)sulfonyl]-
- 5-Chloro-2-[(3,4,4-trifluorobut-3-en-1-yl)sulfonyl]-1,3-thiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fluensulfone 100 µg/mL in Acetonitrile
CAS:Formula:C7H5ClF3NO2S2Color and Shape:Single SolutionMolecular weight:291.70Fluensulfone
CAS:Fluensulfone (MCW-2) is a low-toxicity, eco-friendly nematicide from the fluoroalkenyl thioether group.Formula:C7H5ClF3NO2S2Purity:97.82%Color and Shape:SolidMolecular weight:291.7Ref: TM-T3202
2mg39.00€5mg51.00€10mg86.00€25mg156.00€50mg225.00€100mg321.00€200mg467.00€1mL*10mM (DMSO)58.00€Fluensulfone
CAS:Fluensulfone is a nematicidal chemical that belongs to the group of fumigants. It has been shown to be effective against a wide variety of nematodes, including wild-type mice and juveniles. Fluensulfone is applied as a soil fumigant to control nematodes in agricultural crops such as potatoes and tomatoes. Fluensulfone has been shown to be effective against other pests such as mites, thrips, aphids, and whiteflies.Formula:C7H5ClF3NO2S2Purity:Min. 95%Molecular weight:291.7 g/mol5-Chloro-2-[(3,4,4-trifluorobut-3-en-1-yl)sulfonyl]-1,3-thiazole
CAS:Formula:C7H5ClF3NO2S2Color and Shape:SolidMolecular weight:291.6983







