CymitQuimica logo

CAS 3183-21-9

:

N-propan-2-ylglycine

Description:
N-propan-2-ylglycine, also known as isopropylglycine, is an amino acid derivative characterized by its structure, which includes an isopropyl group attached to the nitrogen of the glycine backbone. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It is typically a white crystalline solid at room temperature and is soluble in water due to the presence of both hydrophilic amino and carboxyl functional groups. N-propan-2-ylglycine exhibits properties typical of amino acids, such as the ability to participate in acid-base reactions, and it can act as a zwitterion in solution. Its potential applications include use in biochemical research, as a building block in organic synthesis, and in the study of metabolic pathways. Additionally, it may have implications in the field of pharmaceuticals, particularly in the development of compounds that modulate neurotransmitter activity. As with many amino acid derivatives, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C5H11NO2
InChI:InChI=1/C5H11NO2/c1-4(2)6-3-5(7)8/h4,6H,3H2,1-2H3,(H,7,8)
InChI key:HEPOIJKOXBKKNJ-UHFFFAOYSA-N
SMILES:CC(C)NCC(=O)O
Synonyms:
  • (Isopropylamino)Acetic Acid
Found 2 products.