CAS 31839-20-0

5-hydroxy-4-methoxy-2-nitrobenzoic acid

Description:

5-Hydroxy-4-methoxy-2-nitrobenzoic acid, with the CAS number 31839-20-0, is an organic compound that belongs to the class of benzoic acids. It features a benzoic acid core substituted with a hydroxyl group (-OH), a methoxy group (-OCH3), and a nitro group (-NO2) at specific positions on the aromatic ring. This compound typically exhibits characteristics such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of hydroxyl and methoxy groups. The nitro group contributes to its reactivity and may influence its acidity and overall chemical behavior. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks. Additionally, compounds like this can have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, depending on their specific properties and reactivity. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.

Formula: C₈H₇NO₆

InChI: InChI=1S/C8H7NO6/c1-15-7-3-5(9(13)14)4(8(11)12)2-6(7)10/h2-3,10H,1H3,(H,11,12)

SMILES: COc1cc(c(cc1O)C(=O)O)N(=O)=O

Synonyms:

• Wnr Dq Bvq Eo1

5-Hydroxy-4-methoxy-2-nitrobenzoic acid

CAS: 31839-20-0

Formula: C₈H₇NO₆

Purity: 96%

Color and Shape: Solid

Molecular weight: 213.1443

Ref: IN-DA00C8LR

5-Hydroxy-4-methoxy-2-nitrobenzoic acid

CAS: 31839-20-0

5-Hydroxy-4-methoxy-2-nitrobenzoic acid

Purity: 99%

Molecular weight: 213.14g/mol

Ref: 54-OR54342

5-Hydroxy-4-methoxy-2-nitrobenzoic acid

CAS: 31839-20-0

Formula: C₈H₇NO₆

Purity: 96%

Color and Shape: Solid

Molecular weight: 213.145

Ref: 10-F075592

5-hydroxy-4-methoxy-2-nitrobenzoic acid

CAS: 31839-20-0

5-hydroxy-4-methoxy-2-nitrobenzoic acid is a synthetic antioxidant that is synthesised from α-tocopherol. It has been shown to be an effective scavenger of hydroxyl radicals and reactive oxygen species, which are involved in the oxidative degradation of biomolecules. 5-Hydroxy-4-methoxy-2-nitrobenzoic acid can be used as an antioxidant in food and cosmetics. This compound also reacts with linoleic acid, forming a phenolic product, which has antioxidant activity.

Formula: C₈H₇NO₆

Purity: Min. 95%

Molecular weight: 213.14 g/mol

Ref: 3D-GBA83920

Gefitinib Impurity 34

CAS: 31839-20-0

Formula: C₈H₇NO₆

Molecular weight: 213.15

Ref: ST-EA-CP-G14041