CAS 318469-36-2
:5-[(4-Bromophenyl)sulfonyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol
Description:
5-[(4-Bromophenyl)sulfonyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol is a chemical compound characterized by its complex structure, which includes a pyrazole ring substituted with various functional groups. The presence of a bromophenyl group indicates a significant degree of lipophilicity, while the sulfonyl moiety contributes to its potential as a reactive electrophile. The trifluoromethyl group enhances the compound's metabolic stability and can influence its biological activity, often increasing lipophilicity and altering electronic properties. The hydroxymethyl group at the pyrazole position may provide sites for further chemical modifications or interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit unique pharmacological properties. Its CAS number, 318469-36-2, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the combination of these functional groups suggests that this compound may possess interesting biological activities, warranting further investigation.
Formula:C12H10BrF3N2O3S
InChI:InChI=1S/C12H10BrF3N2O3S/c1-18-11(9(6-19)10(17-18)12(14,15)16)22(20,21)8-4-2-7(13)3-5-8/h2-5,19H,6H2,1H3
InChI key:InChIKey=RCISSSPINXEHIP-UHFFFAOYSA-N
SMILES:C(O)C1=C(S(=O)(=O)C2=CC=C(Br)C=C2)N(C)N=C1C(F)(F)F
Synonyms:- 1H-Pyrazole-4-methanol, 5-[(4-bromophenyl)sulfonyl]-1-methyl-3-(trifluoromethyl)-
- 5-[(4-Bromophenyl)sulfonyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Bromophenylsulphonyl)-4-(hydroxymethyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazole
CAS:<p>5-(4-Bromophenylsulphonyl)-4-(hydroxymethyl)-1-methyl-3-(trifluoromethyl)-1H-pyrazole</p>Molecular weight:399.18g/mol
