CAS 31858-65-8
:(E)-6-(4,6-dihydroxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid
Description:
The chemical substance known as (E)-6-(4,6-dihydroxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoic acid, with the CAS number 31858-65-8, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including hydroxyl (-OH) and carboxylic acid (-COOH) groups, which contribute to its solubility and reactivity. The presence of the isobenzofuran moiety indicates potential aromatic characteristics, while the hex-4-enoic acid portion suggests unsaturation in the carbon chain, which can influence its chemical behavior and interactions. This compound may exhibit biological activity due to its structural complexity, making it of interest in pharmaceutical and biochemical research. Its stereochemistry, indicated by the (E) configuration, suggests specific spatial arrangements that can affect its interactions with biological targets. Overall, this substance's unique combination of functional groups and structural features positions it as a potentially valuable compound in various chemical and biological applications.
Formula:C16H18O6
InChI:InChI=1/C16H18O6/c1-8(4-6-12(17)18)3-5-10-14(19)9(2)11-7-22-16(21)13(11)15(10)20/h3,19-20H,4-7H2,1-2H3,(H,17,18)/b8-3+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
O-Desmethyl Mycophenolic Acid
CAS:Applications A metabolite of Mycophenolic acid (phase 1 metabolite).
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Nowak, I., et al.: Ther. Drug Monit., 19, 358 (1997), Bullingham, R., et al.: Clin. Pharmacokinet., 34, 429 (1998), Van Gelder, T., et al.: Ther. Drug Monit., 23, 119 (2001), Wen, X., et al.: Drug Metab. Dispos., 30, 631 (2002), Shipkova, M., et al.: Ther. Drug Monit., 25, 1,(2003),Formula:C16H18O6Color and Shape:NeatMolecular weight:306.31
