CAS 3187-53-9

Flemichapparin B

Description:

Flemichapparin B, with the CAS number 3187-53-9, is a naturally occurring compound classified as an alkaloid. It is derived from certain plant species and is known for its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Flemichapparin B may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water, which is common for many alkaloids. Its stability can be influenced by environmental factors such as pH and temperature. Research into Flemichapparin B is ongoing, focusing on its mechanisms of action and potential therapeutic applications. As with many natural products, the extraction and purification processes are critical for obtaining this compound in a form suitable for further study and application.

Formula: C₁₇H₁₂O₅

InChI: InChI=1S/C17H12O5/c1-18-9-2-3-10-13(4-9)19-7-12-11-5-15-16(21-8-20-15)6-14(11)22-17(10)12/h2-6H,7-8H2,1H3

InChI key: InChIKey=XWTCRKNSJARUIU-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(C3=C(C=4C(O3)=CC5=C(C4)OCO5)CO2)=CC1

Synonyms:

• 3-Methoxy-6H-[1,3]dioxolo[4′,5′:5,6]benzofuro[3,2-c]chromene
• 3-Methoxy-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran
• 3-Methoxy-8,9-methylenedioxy-6a,11a-dehydropterocarpan
• 6a,11a-Dehydropisatin
• Anhydropisatin
• Anhydrosophorol, O-methyl-
• Flemichapparin B
• O-Methylanhydrosophorol
• Pisatin, anhydro-
• 6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran, 3-methoxy-

Anhydropisatin

CAS: 3187-53-9

Anhydropisatin is a synthetic compound, which acts as a derivative of pisatin, a phytoalexin originally isolated from plants such as garden peas (Pisum sativum). The mode of action of Anhydropisatin involves disrupting the cell wall integrity of fungi, inhibiting their growth and spread. Its antifungal properties are primarily attributed to its ability to interfere with the synthesis of key structural components within fungal cells.

Formula: C₁₇H₁₂O₅

Purity: Min. 95%

Molecular weight: 296.27 g/mol

Ref: 3D-XA161654