CAS 31872-63-6

3-Bromo-4-chloro-5-nitropyridine

Description:

3-Bromo-4-chloro-5-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three distinct substituents: a bromine atom at the 3-position, a chlorine atom at the 4-position, and a nitro group at the 5-position of the pyridine ring. These substituents contribute to its chemical reactivity and physical properties. Typically, such compounds exhibit moderate to high polarity due to the presence of electronegative halogens and the nitro group, which can influence their solubility in various solvents. The presence of these functional groups also suggests potential applications in pharmaceuticals, agrochemicals, and materials science, as they can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound's structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted, as halogenated and nitro compounds can pose health and environmental risks.

Formula: C₅H₂BrClN₂O₂

InChI: InChI=1/C5H2BrClN2O2/c6-3-1-8-2-4(5(3)7)9(10)11/h1-2H

SMILES: c1c(c(c(cn1)N(=O)=O)Cl)Br

Synonyms:

• Pyridine, 3-Bromo-4-Chloro-5-Nitro-

3-Bromo-4-chloro-5-nitropyridine

CAS: 31872-63-6

Formula: C₅H₂BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.4386

Ref: IN-DA0033M4

3-Bromo-4-chloro-5-nitropyridine

CAS: 31872-63-6

3-Bromo-4-chloro-5-nitropyridine

Formula: C₅H₂BrClN₂O₂

Purity: 98%

Color and Shape: light yellow solid

Molecular weight: 237.44g/mol

Ref: 54-OR46093

3-Bromo-4-chloro-5-nitropyridine

CAS: 31872-63-6

Formula: C₅H₂BrClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 237.44

Ref: 10-F077254