CAS 31874-34-7
:2,4-Dimethoxybenzaldoxime
Description:
2,4-Dimethoxybenzaldoxime is an organic compound characterized by its oxime functional group, which is derived from the corresponding aldehyde, 2,4-dimethoxybenzaldehyde. This compound features a benzene ring substituted with two methoxy groups at the 2 and 4 positions, enhancing its solubility in organic solvents and influencing its reactivity. The oxime group (-C=N-OH) is known for its ability to form stable complexes with metal ions, making it useful in various applications, including coordination chemistry and as a potential ligand. 2,4-Dimethoxybenzaldoxime may exhibit biological activity, and its derivatives are often explored for potential pharmaceutical applications. The compound is typically a solid at room temperature and may have a characteristic odor. Its synthesis generally involves the reaction of the corresponding aldehyde with hydroxylamine under acidic or basic conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+
Synonyms:- 1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine
- 2,4-Dimethoxybenzaldehyde Oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dimethoxybenzaldoxime
CAS:Formula:C9H11NO3Purity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:181.192,4-Dimethoxybenzaldoxime
CAS:2,4-Dimethoxybenzaldoxime is an aldoxime that has been used in the synthesis of formyl compounds. It is a synthetic molecule with a molecular weight of 192.2 g/mol and a melting point of 97°C. 2,4-Dimethoxybenzaldoxime is used to synthesize fulvenes, which are highly reactive molecules that have been shown to be useful in the study of formyl group reactivity. It also has been used as a photosensitizer for photochemical reactions. In addition, it can be used to prepare unsaturated alkyl compounds by reacting with alcohols in the presence of base or acid.Formula:C9H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:181.19 g/mol



