CymitQuimica logo

CAS 31876-69-4

:

1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-one

Description:
1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-one, with the CAS number 31876-69-4, is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity. This compound features a nitro group and a methyl substituent on the imidazole ring, enhancing its reactivity and potential pharmacological properties. The presence of the propan-2-one moiety indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. The compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. Additionally, the nitro group may confer specific electronic properties that influence the compound's reactivity and interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with nitro-containing compounds.
Formula:C7H9N3O3
InChI:InChI=1/C7H9N3O3/c1-5(11)4-9-6(2)8-3-7(9)10(12)13/h3H,4H2,1-2H3
SMILES:CC(=O)Cn1c(C)ncc1N(=O)=O
Synonyms:
  • 2-propanone, 1-(2-methyl-5-nitro-1H-imidazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.