CAS 3189-22-8
:7-Methoxyindole
Description:
7-Methoxyindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The methoxy group (-OCH₃) is attached to the seventh position of the indole ring, influencing its chemical properties and reactivity. This compound is typically a white to light yellow solid and is known for its aromatic characteristics, contributing to its stability and potential biological activity. 7-Methoxyindole is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential roles in pharmacological applications, such as acting as a precursor for the synthesis of other compounds or exhibiting biological activities. Its solubility in organic solvents and limited solubility in water are typical for compounds with similar structures. Additionally, it may participate in various chemical reactions, including electrophilic substitutions, due to the electron-rich nature of the indole ring. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c1-11-8-4-2-3-7-5-6-10-9(7)8/h2-6,10H,1H3
InChI key:InChIKey=FSOPPXYMWZOKRM-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=CN2)=CC=C1
Synonyms:- 1H-Indole, 7-methoxy-
- 7-(Methyloxy)-1H-indole
- 7-Methoxy Indole
- 7-Methoxy-1H-indole
- Indole, 7-methoxy-
- NSC 100739
- 7-Methoxyindole
- 7-METHOYINDOLE-REGULATED
- 7-METHOXY ISOFLAVONE
- 7-Methoxyindole ,98%
- 7-METHOYINDOLE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
7-Methoxyindole, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H9NOPurity:97%Color and Shape:Colorless to brown, LiquidMolecular weight:147.187-Methoxy-1H-indole
CAS:7-Methoxy-1H-indoleFormula:C9H9NOPurity:98%Color and Shape: colourless liquidMolecular weight:147.17g/mol7-Methoxyindole
CAS:Formula:C9H9NOPurity:>98.0%(GC)Color and Shape:Colorless to Brown clear liquidMolecular weight:147.187-Methoxy-1H-indole
CAS:7-Methoxy-1H-indole (7MI) is a synthetic compound that exhibits anti-inflammatory activity. It is an analog of the amino acid methionine found in proteins and its synthesis involves the condensation of a chlorinated alkyl acetate with an esterified hydrazide to form the corresponding amide. 7MI has been shown to inhibit both bacterial and mammalian protein synthesis, as well as to inhibit tumor cell growth. 7MI binds reversibly to the N7 atom of the adenine base in DNA, thereby inhibiting DNA replication through inhibition of DNA polymerase.Formula:C9H9NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:147.17 g/mol






