CAS 3189-48-8

indolizine-2-carboxylic acid

Description:

Indolizine-2-carboxylic acid is a heterocyclic organic compound characterized by its indolizine core, which consists of a five-membered ring containing nitrogen. This compound features a carboxylic acid functional group (-COOH) at the second position of the indolizine ring, contributing to its acidic properties. Indolizine derivatives are known for their diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate interactions with biological targets. Additionally, indolizine-2-carboxylic acid can participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Its structural features may also allow for the formation of coordination complexes with metal ions, expanding its utility in materials science and catalysis. Overall, indolizine-2-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry due to its unique structure and reactivity.

Formula: C₉H₇NO₂

InChI: InChI=1/C9H7NO2/c11-9(12)7-5-8-3-1-2-4-10(8)6-7/h1-6H,(H,11,12)

SMILES: c1ccn2cc(cc2c1)C(=O)O

Synonyms:

• 2-Indolizinecarboxylic Acid
• Acide 2-indolizinecarboxylique
• INDOLIZINE-2-CARBOXYLIC ACID

Indolizine-2-carboxylic acid

CAS: 3189-48-8

Formula: C₉H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.1574

Ref: IN-DA00C81F

Indolizine-2-carboxylic acid

CAS: 3189-48-8

Indolizine-2-carboxylic acid

Purity: 97%

Molecular weight: 161.15738g/mol

Ref: 54-OR75437

Indolizine-2-carboxylic acid

CAS: 3189-48-8

Formula: C₉H₇NO₂

Purity: 97%

Molecular weight: 161.16

Ref: 10-F329688

Indolizine-2-carboxylic Acid

Controlled Product

CAS: 3189-48-8

Formula: C₉H₇NO₂

Color and Shape: Neat

Molecular weight: 161.16

Ref: TR-I627270