CAS 31897-97-9

N-methyl-2-(tricyclo[3.3.1.1~3,7~]dec-1-yl)ethanamine hydrochloride (1:1)

Description:

N-methyl-2-(tricyclo[3.3.1.1~3,7~]dec-1-yl)ethanamine hydrochloride is a chemical compound characterized by its complex tricyclic structure, which contributes to its unique properties. This substance is a derivative of ethanamine, featuring a methyl group and a tricyclic decane moiety that influences its steric and electronic characteristics. The hydrochloride form indicates that it is a salt, which typically enhances its solubility in water and stability. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems, making it of interest in pharmacological research. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many amines, it may exhibit basic properties, forming stable salts with acids. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in various fields.

Formula: C₁₃H₂₄ClN

InChI: InChI=1/C13H23N.ClH/c1-14-3-2-13-7-10-4-11(8-13)6-12(5-10)9-13;/h10-12,14H,2-9H2,1H3;1H

SMILES: CNCCC12CC3CC(CC(C3)C2)C1.Cl

Synonyms:

• 2-(Adamantan-1-yl)-N-methylethanamine hydrochloride (1:1)
• tricyclo[3.3.1.1~3,7~]decane-1-ethanamine, N-methyl-, hydrochloride (1:1)

[2-(1-adamantyl)ethyl]methylamine hydrochloride

CAS: 31897-97-9

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 229.7899932861328

Ref: 10-F360962