CAS 319-60-8
:3,5-Difluoro-4-methoxybenzoic acid
Description:
3,5-Difluoro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group attached to a benzoic acid framework. The molecular structure features a benzene ring substituted at the 3 and 5 positions with fluorine atoms and at the 4 position with a methoxy group (-OCH3). This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. Additionally, the methoxy group can affect the compound's electronic properties and reactivity. Overall, 3,5-Difluoro-4-methoxybenzoic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C8H6F2O3
InChI:InChI=1/C8H6F2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12)
SMILES:COc1c(cc(cc1F)C(=O)O)F
Synonyms:- 3,5-Difluoro-p-anisic acid
- 319-60-8
- Qvr Cf Ef Do1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Difluoro-4-methoxybenzoic acid
CAS:Formula:C8H6F2O3Purity:98%Color and Shape:SolidMolecular weight:188.12823,5-Difluoro-4-methoxybenzoic acid
CAS:3,5-Difluoro-4-methoxybenzoic acidFormula:C8H6F2O3Purity:99%Color and Shape: white crystalline powderMolecular weight:188.13g/mol3,5-Difluoro-4-methoxybenzoic acid
CAS:3,5-Difluoro-4-methoxybenzoic acid is a chemical compound that is used as both a starting material and an intermediate in organic synthesis. It can be obtained from the reaction of 2,4-difluoro-3-methoxybenzoyl chloride with 3,5-dimethoxyaniline. 3,5-Difluoro-4-methoxybenzoic acid has been shown to be useful as a building block in the synthesis of other compounds with potent antibiotic activity such as fluoroquinolones. This compound is also used to synthesize aminomethylcyclohexane and methylaminomethylcyclohexane, which are useful in the manufacture of pesticides.Formula:C8H6F2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:188.13 g/mol3,5-Difluoro-4-methoxybenzoic acid
CAS:Formula:C8H6F2O3Purity:98%Color and Shape:White to off-white fine powderMolecular weight:188.13



