CAS 319-87-9
:1,2,3,4,5-pentachloro-6-fluorobenzene
Description:
1,2,3,4,5-Pentachloro-6-fluorobenzene, with the CAS number 319-87-9, is a chlorinated aromatic compound characterized by the presence of five chlorine atoms and one fluorine atom attached to a benzene ring. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its physical state at room temperature. It is known for its high stability and resistance to degradation, which can pose environmental concerns due to its persistence. The presence of multiple chlorine atoms contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. This compound is often utilized in various industrial applications, including as an intermediate in the synthesis of other chemicals and in agrochemical formulations. Its chemical properties include a relatively high boiling point and melting point, reflecting the strong intermolecular forces due to the halogen substituents. Safety precautions are essential when handling this substance, as it may exhibit toxicological effects and environmental hazards.
Formula:C6Cl5F
InChI:InChI=1/C6Cl5F/c7-1-2(8)4(10)6(12)5(11)3(1)9
SMILES:c1(c(c(c(c(c1Cl)Cl)F)Cl)Cl)Cl
Synonyms:- Benzene, pentachlorofluoro-
- Fluoropentachlorobenzene
- Pentachlorofluorobenzene
- Pentchlorofluorobenzene
- 1-Chloro-2,3,4,5,6-pentachlorofluorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,2,3,4,5-Pentachloro-6-fluorobenzene
CAS:<p>1,2,3,4,5-Pentachloro-6-fluorobenzene</p>Purity:≥95%Color and Shape:SolidMolecular weight:268.33g/mol1,2,3,4,5-Pentachloro-6-fluorobenzene
CAS:<p>1,2,3,4,5-Pentachloro-6-fluorobenzene is a compound with predominately hydrogen fluoride and a hydroxy group. It is an organic solvent that can be used in chemical ionization and chlorinating reactions. It has been shown to have acidic properties and can react with nitro groups to form an inorganic coordination complex. 1,2,3,4,5-Pentachloro-6-fluorobenzene also contains impurities such as chloride which should be noted when handling this compound.</p>Formula:C6Cl5FPurity:Min. 95%Molecular weight:268.33 g/mol

