CymitQuimica logo

CAS 319-91-5

:

2-Fluoro-1,3,4,5-tetramethylbenzene

Description:
2-Fluoro-1,3,4,5-tetramethylbenzene, also known as 2-fluoro-1,3,4,5-tetramethylbenzene, is an aromatic compound characterized by a benzene ring substituted with four methyl groups and one fluorine atom. The presence of the fluorine atom introduces unique properties, such as increased electronegativity and potential reactivity compared to its non-fluorinated counterparts. This compound typically exhibits a high degree of hydrophobicity due to the bulky methyl groups, which can influence its solubility in various solvents. Its molecular structure contributes to its stability, but the fluorine substitution can also affect its reactivity in electrophilic aromatic substitution reactions. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and agrochemicals. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose environmental and health risks. Overall, 2-fluoro-1,3,4,5-tetramethylbenzene is a notable compound in the study of fluorinated aromatic compounds.
Formula:C10H13F
InChI:InChI=1S/C10H13F/c1-6-5-7(2)10(11)9(4)8(6)3/h5H,1-4H3
InChI key:InChIKey=WGOOHIBXEKJTGZ-UHFFFAOYSA-N
SMILES:CC1=C(C)C(F)=C(C)C=C1C
Synonyms:
  • 2,3,4,6-Tetramethyl-1-fluorobenzene
  • Benzene, 2-fluoro-1,3,4,5-tetramethyl-
  • NSC 98327
  • 2-Fluoro-1,3,4,5-tetramethylbenzene
  • 1-Fluoro-2,3,4,6-tetramethylbenzene
Found 4 products.