CAS 31910-18-6

1,4-Dihydro-6-methoxy-2,3-quinoxalinedione

Description:

1,4-Dihydro-6-methoxy-2,3-quinoxalinedione, with the CAS number 31910-18-6, is a chemical compound that belongs to the quinoxaline family, characterized by its bicyclic structure containing two nitrogen atoms. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in organic solvents. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. The presence of the methoxy group enhances its reactivity and solubility, influencing its interaction with biological targets. Additionally, the compound may undergo various chemical reactions, such as oxidation and substitution, which can modify its properties and applications. Its stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 1,4-Dihydro-6-methoxy-2,3-quinoxalinedione serves as a valuable compound in medicinal chemistry and material science, warranting further investigation into its potential uses and mechanisms of action.

Formula: C₉H₈N₂O₃

InChI: InChI=1S/C9H8N2O3/c1-14-5-2-3-6-7(4-5)11-9(13)8(12)10-6/h2-4H,1H3,(H,10,12)(H,11,13)

InChI key: InChIKey=CHTYMWBYHAIEOF-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(NC(=O)C(=O)N2)=CC1

Synonyms:

• 1,4-Dihydro-6-methoxy-2,3-quinoxalinedione
• 2(1H)-Quinoxalinone, 3-hydroxy-6-methoxy-
• 2,3-Quinoxalinediol, 6-methoxy-
• 2,3-Quinoxalinedione, 1,4-dihydro-6-methoxy-
• 6-Methoxy-1,4-Dihydroquinoxaline-2,3-Dione
• 6-methoxyquinoxaline-2,3(1H,4H)-dione

2,3-DIHYDROXY-6-METHOXYQUINOXALINE

CAS: 31910-18-6

Formula: C₉H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 192.1714

Ref: IN-DA00C7CJ

2,3-Dihydroxy-6-methoxyquinoxaline

CAS: 31910-18-6

2,3-Dihydroxy-6-methoxyquinoxaline

Purity: ≥95%

Ref: 54-OR11162

6-Methoxy-1,4-dihydroquinoxaline-2,3-dione

CAS: 31910-18-6

6-Methoxy-1,4-dihydroquinoxaline-2,3-dione is a nitrile that is generated by the catalytic oxidation of quinoxaline. It is a colorless to yellow solid with a melting point of about 155°C. 6-Methoxy-1,4-dihydroquinoxaline-2,3-dione has been shown to be an effective nitrile for the synthesis of diketene. 6-Methoxy-1,4-dihydroquinoxaline-2,3-dione can be converted into hydrochloric acid and ethanol through hydrolysis with hydrochloric acid or ethanol in the presence of heat. This reaction will proceed more quickly at higher temperatures. The filtration method can be used to remove any unwanted solids from the reaction mixture.

Formula: C₉H₈N₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 192.17 g/mol

Ref: 3D-FM132335

6-Methoxyquinoxaline-2,3-diol

CAS: 31910-18-6

Formula: C₉H₈N₂O₃

Purity: 95.0%

Molecular weight: 192.174

Ref: 10-F219532