CAS 319457-34-6
:2-Acetyl-3,6-difluorobenzoic acid
Description:
2-Acetyl-3,6-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both an acetyl group and two fluorine atoms on the benzene ring. The molecular structure features a benzoic acid core, with the acetyl group (–COCH3) attached to the second carbon and fluorine substituents at the third and sixth positions of the ring. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it useful in various chemical syntheses and applications. Additionally, the compound may exhibit interesting biological properties, which can be explored in pharmaceutical research. Its unique structure allows for potential applications in materials science and organic synthesis, where fluorinated compounds are often sought for their distinctive properties. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C9H6F2O3
InChI:InChI=1/C9H6F2O3/c1-4(12)7-5(10)2-3-6(11)8(7)9(13)14/h2-3H,1H3,(H,13,14)
SMILES:CC(=O)c1c(ccc(c1C(=O)O)F)F
Synonyms:- Benzoic acid, 2-acetyl-3,6-difluoro-
- Qvr Bf Ef Fv1 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetyl-3,6-difluorobenzoic acid
CAS:2-Acetyl-3,6-difluorobenzoic acidPurity:≥95%Molecular weight:200.14g/mol2-Acetyl-3,6-difluorobenzoic acid
CAS:2-Acetyl-3,6-difluorobenzoic acid is a high quality fine chemical. It is a useful building block for the synthesis of diverse compounds of biological and pharmaceutical interest. It is also used as a reaction component in the preparation of other chemicals and as a reagent in organic synthesis. 2-Acetyl-3,6-difluorobenzoic acid has been shown to have antimicrobial properties.Formula:C9H6F2O3Purity:Min. 90%Color and Shape:PowderMolecular weight:200.14 g/mol2-Acetyl-3,6-difluorobenzoic acid
CAS:Formula:C9H6F2O3Purity:98.0%Color and Shape:SolidMolecular weight:200.141



