CAS 319474-34-5

4-Iodo-1H-pyrrolo[2,3-b]pyridine

Description:

4-Iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, with an iodine substituent at the 4-position of the pyrrole moiety. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the iodine atom can enhance the compound's reactivity and influence its pharmacokinetic properties. Additionally, 4-Iodo-1H-pyrrolo[2,3-b]pyridine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Its unique structural features and reactivity profile make it a subject of research in the fields of organic synthesis and pharmacology. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₅IN₂

InChI: InChI=1/C7H5IN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10)

SMILES: c1cnc2c1c(cc[nH]2)I

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 4-iodo-
• 4-Iod-1H-pyrrolo[2,3-b]pyridin

4-Iodo-7-azaindole

CAS: 319474-34-5

Formula: C₇H₅IN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 244.0325

Ref: IN-DA003LK4

4-Iodo-1H-pyrrolo[2,3-b]pyridine

CAS: 319474-34-5

4-Iodo-1H-pyrrolo[2,3-b]pyridine

Purity: 97%

Molecular weight: 244.03g/mol

Ref: 54-OR90356

4-Iodo-7-azaindole

CAS: 319474-34-5

Formula: C₇H₅IN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 244.035

Ref: 10-F076221