CAS 319492-96-1

7-isopropoxy-6-methoxy-4-oxo-1H-quinoline-3-carbonitrile

Description:

7-Isopropoxy-6-methoxy-4-oxo-1H-quinoline-3-carbonitrile is a synthetic organic compound characterized by its quinoline core structure, which is a bicyclic aromatic compound known for its diverse biological activities. The presence of the isopropoxy and methoxy groups contributes to its solubility and reactivity, potentially influencing its pharmacological properties. The carbonitrile functional group adds to its chemical reactivity, making it a candidate for various chemical transformations. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, typical of quinoline derivatives. Its molecular structure allows for interactions with biological targets, which can be explored in medicinal chemistry. The compound's stability, solubility, and reactivity can be influenced by the substituents on the quinoline ring, making it a subject of interest in drug development and research. As with many synthetic compounds, safety and handling precautions are essential, and its effects on biological systems should be studied comprehensively to understand its potential applications.

Formula: C₁₄H₁₄N₂O₃

InChI: InChI=1/C14H14N2O3/c1-8(2)19-13-5-11-10(4-12(13)18-3)14(17)9(6-15)7-16-11/h4-5,7-8H,1-3H3,(H,16,17)

7-Isopropoxy-6-methoxy-4-oxo-1,4-dihydroquinoline-3-carbonitrile

CAS: 319492-96-1

7-Isopropoxy-6-methoxy-4-oxo-1,4-dihydroquinoline 3-carbonitrile (7OMeOQ) is a research tool that has been used to study the binding of ligands to receptors and ion channels. 7OMeOQ has been shown to be an activator of nicotinic acetylcholine receptors in cells, as well as an inhibitor of acetylcholinesterase enzyme. 7OMeOQ has also been shown to inhibit the production of antibodies by B cells. This compound can be used for research purposes in cell biology, pharmacology, and peptides.

Formula: C₁₄H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 258.27 g/mol

Ref: 3D-UMA49296