CAS 3195-78-6

N-Methyl-N-vinylacetamide

Description:

N-Methyl-N-vinylacetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. It features a vinyl group, making it a reactive monomer suitable for polymerization processes. The compound has a molecular structure that includes a methyl group attached to the nitrogen atom, enhancing its solubility in polar solvents. N-Methyl-N-vinylacetamide is typically a colorless to pale yellow liquid with a characteristic odor. It is known for its ability to undergo free radical polymerization, which allows it to be utilized in the synthesis of various polymers and copolymers. This compound exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. Its applications span across industries, including adhesives, coatings, and textiles, where it contributes to the development of materials with desirable properties such as flexibility and adhesion. As with many chemical substances, proper storage and handling are essential to ensure safety and stability.

Formula: C₅H₉NO

InChI: InChI=1S/C5H9NO/c1-4-6(3)5(2)7/h4H,1H2,2-3H3

InChI key: InChIKey=PNLUGRYDUHRLOF-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C=C)C

Synonyms:

• Acetamide, N-ethenyl-N-methyl-
• Acetamide, N-methyl-N-vinyl-
• N-Methyl-N-vinylacetamide
• N-ethenyl-N-methylacetamide
• N-Vinyl-N-methylacetamide

Acetamide, N-​ethenyl-​N-​methyl-

CAS: 3195-78-6

Formula: C₅H₉NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 99.1311

Ref: IN-DA003T8A

N-Methyl-N-vinylacetamide

CAS: 3195-78-6

N-Methyl-N-vinylacetamide

Purity: 98%

Molecular weight: 99.13g/mol

Ref: 54-OR80447

N-Methyl-N-vinylacetamide

CAS: 3195-78-6

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 99.13300323486328

Ref: 10-F235676

N-Methyl-N-vinylacetamide

CAS: 3195-78-6

Formula: C₅H₉NO

Color and Shape: Neat

Molecular weight: 99.13

Ref: 04-CA15147700

N-Methyl-N-vinylacetamide

CAS: 3195-78-6

N-Methyl-N-vinylacetamide is a colorless liquid with a boiling point of 105.6°C. It is produced by the reaction of acetamide and vinyl chloride in the presence of hydrochloric acid, glycol ether, and methyl ethyl ketone. The viscosity of this compound is low, which makes it an ideal solvent for paints and coatings. N-Methyl-N-vinylacetamide also has genetic damaging effects and can cause mutations in bacteria that are exposed to this compound in high concentrations. This product has an unusual chemical structure due to its hydrogen bonding interactions.br>br>
br>br>
Hydrogen bonds are weak intermolecular forces between polar molecules, such as water or alcohols, that are formed by the attraction between a partially positive hydrogen atom on one molecule and the negative end of another nearby molecule. Hydrogen bonds stabilize certain molecular structures because they provide partial shielding from electrostatic interactions with

Formula: C₅H₉NO

Purity: Min. 97.5%

Color and Shape: Clear Liquid

Molecular weight: 99.13 g/mol

Ref: 3D-FM25912

N-Methyl-N-vinylacetamide

Controlled Product

CAS: 3195-78-6

Formula: C₅H₉NO

Color and Shape: Yellow

Molecular weight: 99.13

Ref: TR-M338550