CAS 31962-35-3
:1H-pyrazole-4,5-dicarboxylic acid
Description:
1H-pyrazole-4,5-dicarboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms at the 1 and 2 positions. This compound features two carboxylic acid functional groups located at the 4 and 5 positions of the pyrazole ring, contributing to its acidic properties. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups. The compound is of interest in various fields, including medicinal chemistry and agricultural chemistry, due to its potential biological activities and applications in the synthesis of other chemical entities. Its reactivity is influenced by the electron-withdrawing nature of the carboxylic acid groups, which can participate in various chemical reactions, including esterification and amidation. Additionally, 1H-pyrazole-4,5-dicarboxylic acid may exhibit chelating properties, making it useful in coordination chemistry.
Formula:C5H4N2O4
InChI:InChI=1/C5H4N2O4/c8-4(9)2-1-6-7-3(2)5(10)11/h1H,(H,6,7)(H,8,9)(H,10,11)
SMILES:c1c(c(C(=O)O)n[nH]1)C(=O)O
Synonyms:- 31962-35-3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrazole-3,4-dicarboxylic acid
CAS:1H-Pyrazole-3,4-dicarboxylic acidPurity:98%Molecular weight:156.1g/mol1H-Pyrazole-3,4-dicarboxylic acid
CAS:<p>1H-Pyrazole-3,4-dicarboxylic acid is an organic compound that is a white solid. It is a proton acceptor and stabilizer in ammonium formate. In the presence of amide and cyanoformate, it has been shown to inhibit neprilysin activity. 1H-Pyrazole-3,4-dicarboxylic acid also has membrane properties and can be used as a viscosity modifier for polyphosphoric acid. This compound also has some acid moieties that can modulate its solubility in organic solvents.</p>Formula:C5H4N2O4Purity:Min. 95%Molecular weight:156.1 g/mol



