CAS 31962-88-6
:1-(2-deoxy-beta-D-erythro-pentofuranosyl)-4-hydroxytetrahydropyrimidin-2(1H)-one
Description:
1-(2-Deoxy-beta-D-erythro-pentofuranosyl)-4-hydroxytetrahydropyrimidin-2(1H)-one, with the CAS number 31962-88-6, is a nucleoside analog characterized by its unique structural features that combine a pentofuranosyl sugar moiety with a tetrahydropyrimidinone base. This compound typically exhibits properties associated with nucleosides, such as potential biological activity, particularly in the context of antiviral or anticancer research. The presence of the hydroxyl group at the 4-position of the tetrahydropyrimidinone ring may contribute to its reactivity and interactions with biological targets. Additionally, the 2-deoxy configuration of the sugar indicates that it lacks a hydroxyl group at the 2' position, which is a common feature in many nucleoside analogs that enhances their stability and bioavailability. The compound's solubility, stability, and reactivity can vary based on environmental conditions, making it of interest for further studies in medicinal chemistry and pharmacology.
Formula:C9H16N2O5
InChI:InChI=1/C9H16N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h5-8,12-14H,1-4H2,(H,10,15)/t5-,6+,7?,8+/m0/s1
Synonyms:- 2(1H)-Pyrimidinone, 1-(2-deoxy-beta-D-erythro-pentofuranosyl)tetrahydro-4-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2'-Deoxy-3,4,5,6-tetrahydrouridine
CAS:2'-Deoxy-3,4,5,6-tetrahydrouridine (2DTHR) is a cytidine deaminase inhibitor that is used in vitro to inhibit the production of tumor necrosis factor (TNF). 2DTHR has been shown to be active against hepatocellular carcinoma cells. It is also reactive with tumor tissue and can be eliminated at a rate similar to that of deoxycytidine kinase. This drug binds to the enzyme target and inhibits its activity by increasing enzyme levels, which causes cell death. 2DTHR inhibits TNF production in tumor tissue by binding to cytidine deaminase and preventing conversion of cytidine into uracil. This drug has been shown to cause tumor inhibition in vitro.
Formula:C9H16N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:232.23 g/mol
