CAS 31964-03-1

1-(2-methyl-1H-imidazol-1-yl)propan-2-one

Description:

1-(2-methyl-1H-imidazol-1-yl)propan-2-one, with the CAS number 31964-03-1, is an organic compound characterized by its imidazole ring structure, which contributes to its unique chemical properties. This substance features a propan-2-one moiety, indicating the presence of a ketone functional group, which is known for its reactivity in various chemical reactions, including nucleophilic additions. The presence of the 2-methyl-1H-imidazole group enhances its potential as a ligand in coordination chemistry and may impart biological activity, making it of interest in pharmaceutical research. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in polar solvents suggests it can participate in hydrogen bonding, which is significant for its interactions in biological systems. Additionally, the compound's stability and reactivity can be influenced by the substituents on the imidazole ring, making it a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₇H₁₀N₂O

InChI: InChI=1/C7H10N2O/c1-6(10)5-9-4-3-8-7(9)2/h3-4H,5H2,1-2H3

SMILES: CC(=O)Cn1ccnc1C

Synonyms:

• 2-propanone, 1-(2-methyl-1H-imidazol-1-yl)-