CAS 31965-37-4
:Dehydrocyclopeptine
Description:
Dehydrocyclopeptine, with the CAS number 31965-37-4, is a cyclic peptide that exhibits unique structural and chemical characteristics. It is derived from natural sources and is known for its potential biological activities, including antimicrobial and cytotoxic properties. The cyclic structure of dehydrocyclopeptine contributes to its stability and specificity in interactions with biological targets. This compound typically features a series of amino acids linked in a ring formation, which can influence its solubility and reactivity. The presence of dehydro groups in its structure may enhance its reactivity and biological activity compared to its saturated counterparts. Dehydrocyclopeptine is of interest in medicinal chemistry and drug development due to its potential therapeutic applications. However, detailed studies on its pharmacokinetics, mechanisms of action, and safety profiles are essential for understanding its full potential in clinical settings. As with many cyclic peptides, its synthesis and modification can lead to derivatives with enhanced properties, making it a subject of ongoing research in the field of bioactive compounds.
Formula:C17H14N2O2
InChI:InChI=1S/C17H14N2O2/c1-19-15(11-12-7-3-2-4-8-12)16(20)18-14-10-6-5-9-13(14)17(19)21/h2-11H,1H3,(H,18,20)
InChI key:InChIKey=FYVKHLSOIIPVEH-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)C(=CC3=CC=CC=C3)N1C)=CC=CC2
Synonyms:- Cyclopeptine, dehydro-
- 3,4-Dihydro-4-methyl-3-(phenylmethylene)-1H-1,4-benzodiazepine-2,5-dione
- 1H-1,4-Benzodiazepine-2,5-dione, 3-benzylidene-3,4-dihydro-4-methyl-
- 1H-1,4-Benzodiazepine-2,5-dione, 3,4-dihydro-4-methyl-3-(phenylmethylene)-
- Dehydrocyclopeptine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dehydrocyclopeptine
CAS:Dehydrocyclopeptine is a natural product that can be used as a reference standard. The CAS number of Dehydrocyclopeptine is 31965-37-4.Formula:C17H14N2O2Color and Shape:SolidMolecular weight:278.311Dehydrocyclopeptine (Mixture of Conformers)
CAS:Controlled ProductFormula:C17H14N2O2Color and Shape:NeatMolecular weight:278.305

