CAS 31966-70-8
:rel-(1R,2S)-1,2-Dihydro-1,2-naphthalenediol
Description:
Rel-(1R,2S)-1,2-Dihydro-1,2-naphthalenediol, with the CAS number 31966-70-8, is a chiral organic compound characterized by its naphthalene structure, which consists of two fused aromatic rings. This compound features two hydroxyl (-OH) groups attached to the first and second carbon atoms of the naphthalene system, contributing to its diol classification. The specific stereochemistry indicated by the (1R,2S) notation suggests that the compound has distinct spatial arrangements, which can influence its chemical reactivity and interactions with biological systems. Typically, dihydroxynaphthalenes exhibit properties such as solubility in organic solvents and potential applications in organic synthesis, pharmaceuticals, and materials science. The presence of hydroxyl groups enhances hydrogen bonding capabilities, affecting the compound's physical properties, such as melting and boiling points. Additionally, the compound may participate in various chemical reactions, including oxidation and substitution, making it of interest in synthetic organic chemistry. Overall, rel-(1R,2S)-1,2-Dihydro-1,2-naphthalenediol is a valuable compound for research and industrial applications due to its unique structural and chemical characteristics.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H/t9-,10+/m1/s1
InChI key:InChIKey=QPUHWUSUBHNZCG-NLJMKPLXNA-N
SMILES:O[C@H]1C=2C(C=C[C@H]1O)=CC=CC2
Synonyms:- 1,2-Naphthalenediol, 1,2-dihydro-, (1R,2S)-rel-
- 1,2-Naphthalenediol, 1,2-dihydro-, cis-
- Naphthalene cis-1,2-dihydrodiol
- cis-1,2-Dihydro-1,2-naphthalenediol
- cis-1,2-Dihydronaphthalene-1,2-diol
- cis-1,2-Dihydroxy-1,2-dihydronaphthalene
- rel-(1R,2S)-1,2-Dihydro-1,2-naphthalenediol
- syn-1,2-Dihydro-1,2-naphthalenediol
- (1R,2S)-1,2-dihydronaphthalene-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
syn-1,2-Dihydro-1,2-naphthalenediol
CAS:Controlled ProductFormula:C10H10O2Color and Shape:Off-WhiteMolecular weight:162.185
