CAS 3197-19-1

N-[3-(dimethylamino)propyl]acetamide

Description:

N-[3-(dimethylamino)propyl]acetamide, with the CAS number 3197-19-1, is an organic compound characterized by its amide functional group and a dimethylamino substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in water and various organic solvents, which enhances its utility in chemical applications. The presence of the dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acylation processes. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic applications. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, N-[3-(dimethylamino)propyl]acetamide is a versatile compound with applications in both industrial and research settings.

Formula: C₇H₁₆N₂O

InChI: InChI=1/C7H16N2O/c1-7(10)8-5-4-6-9(2)3/h4-6H2,1-3H3,(H,8,10)

SMILES: CC(=NCCCN(C)C)O

Synonyms:

• acetamide, N-[3-(dimethylamino)propyl]-

N-[3-(Dimethylamino)propyl]acetamide

CAS: 3197-19-1

Formula: C₇H₁₆N₂O

Purity: 95%

Molecular weight: 144.2147

Ref: IN-DA00I622

N-[3-(Dimethylamino)propyl]acetamide

CAS: 3197-19-1

N-[3-(Dimethylamino)propyl]acetamide

Purity: ≥95%

Molecular weight: 144.21g/mol

Ref: 54-OR471086