CAS 3198-15-0
:Benzenemethanol, α-[(1S)-1-aminoethyl]-, hydrochloride (1:1), (αR)-
Description:
Benzenemethanol, α-[(1S)-1-aminoethyl]-, hydrochloride (1:1), (αR)-, commonly referred to as a specific amino alcohol derivative, is characterized by its structural features that include a benzene ring attached to a methanol group and an aminoethyl side chain. This compound typically exists as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceuticals. The presence of the amino group contributes to its basicity and potential reactivity, making it suitable for various chemical reactions, including those involving amine functionalities. The (1S) configuration indicates specific stereochemistry, which can influence the compound's biological activity and interactions. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit properties such as being a chiral molecule, which can be significant in drug development and synthesis. Overall, its unique structural and chemical properties make it of interest in medicinal chemistry and related fields.
Formula:C9H13NO·ClH
InChI:InChI=1S/C9H13NO.ClH/c1-7(10)9(11)8-5-3-2-4-6-8;/h2-7,9,11H,10H2,1H3;1H/t7-,9-;/m0./s1
InChI key:InChIKey=DYWNLSQWJMTVGJ-KUSKTZOESA-N
SMILES:[C@@H]([C@H](C)N)(O)C1=CC=CC=C1.Cl
Synonyms:- (1R,2S)-(-)-Norephedrine hydrochloride
- 2-Amino-1-Phenylpropan-1-Ol
- 2-Amino-1-phenyl-1-propanol hydrochloride
- <span class="text-smallcaps">D</span>-(-)-Norephedrine hydrochloride
- Benzenemethanol, α-(1-aminoethyl)-, hydrochloride, [R-(R*,S*)]-
- Benzenemethanol, α-[(1S)-1-aminoethyl]-, hydrochloride (1:1), (αR)-
- Benzenemethanol, α-[(1S)-1-aminoethyl]-, hydrochloride, (αR)-
- NSC 24522
- Phenylpropanolamine hydrochloride
- l-Norephedrine hydrochloride
- l-Phenylpropanolamine hydrochloride
- D-(-)-Norephedrine hydrochloride
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1R,2S)-Norephedrine Hydrochloride
CAS:Controlled ProductStability: Hygroscopic
Applications: (1R,2S)-Norephedrine Hydrochloride is a hydrochloride salt of (1R,2S)-Norephedrine (N674400), a metabolite of Phenmetrazine, an ephedrine alkaloid and a nervous system stimulant.
References Jian, Z., et al.: Planta Med., 54, 69 (1988);Tanaka, T., et al.: Nat. Med., 49, 418 (1995);Marchei, E., et al.: J. Pharm. Biomed. Anal., 41, 1633 (2006)Formula:C9H13NO·HClColor and Shape:NeatMolecular weight:187.67


