CAS 3198-49-0
:Ethyl β-D-glucopyranoside
Description:
Ethyl β-D-glucopyranoside is a glycoside derived from glucose, characterized by the presence of an ethyl group attached to the anomeric carbon of the glucose molecule. It is a colorless, viscous liquid that is soluble in water and exhibits sweet taste properties, making it relevant in food and pharmaceutical applications. The compound has a molecular formula that reflects its glycosidic structure, and it typically exists in a stable pyranose form, which is a six-membered ring structure. Ethyl β-D-glucopyranoside is known for its role as a carbohydrate source and can participate in various biochemical reactions, including enzymatic hydrolysis. Its stability and solubility make it useful in various formulations, including those in the cosmetic and food industries. Additionally, it can serve as a building block in organic synthesis, contributing to the development of more complex carbohydrate derivatives. Safety data indicates that it should be handled with care, as with many chemical substances, to avoid potential hazards.
Formula:C8H16O6
InChI:InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8-/m1/s1
InChI key:InChIKey=WYUFTYLVLQZQNH-JAJWTYFOSA-N
SMILES:O(CC)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- 1-O-Ethyl-b-D-glucopyranoside
- 1-O-Ethyl-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Ethyl <span class="text-smallcaps">D</span>-glucopyranoside
- Ethyl D-glucopyranoside
- Ethyl b-D-glucopyranoside
- Ethyl β-<span class="text-smallcaps">D</span>-glucopyranoside
- Glucopyranoside, ethyl, b-D-
- Glucopyranoside, ethyl, β-<span class="text-smallcaps">D</span>-
- Glucopyranoside,ethyl
- Sucraph AG 6202
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, ethyl
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Ethyl β-d-glucopyranoside
CAS:Formula:C8H16O6Purity:97%Color and Shape:SolidMolecular weight:208.2090Ethyl D-glucopyranoside
CAS:Formula:C8H16O6Purity:≥ 95.0%Color and Shape:White to light yellow oily liquidMolecular weight:208.2Ethyl β-d-glucopyranoside
CAS:Ethyl β-d-glucopyranosideFormula:C8H16O6Purity:98%Color and Shape: light brown solidMolecular weight:208.21g/molEthyl glucoside
CAS:Ethyl glucoside: Natural from Sisyrinchium palmifolium, used in water-based drilling fluids, initiates enzyme-driven lactone polymerization.Formula:C8H16O6Purity:99.44%Color and Shape:SolidMolecular weight:208.21Ethyl β-D-Glucopyranoside
CAS:Formula:C8H16O6Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:208.21Ethyl β-D-glucopyranoside
CAS:<p>Ethyl β-D-glucopyranoside is a fatty acid with the chemical formula CH 3 (CHOH) 2 CH(OH)CH 2 OH. It is a reaction product of inulin and levulinate. Ethyl β-D-glucopyranoside can be used as a control agent for urine samples to test for microbial infection. It also has an inhibitory effect on the growth of microbes, such as bacteria and fungi, which may be due to its ability to disrupt the cell membrane. Ethyl β-D-glucopyranoside is also known to have detergent properties that can be used in soaps and detergents.</p>Formula:C8H16O6Purity:Min. 98 Area-%Color and Shape:Clear Viscous Liquid Solidified MassMolecular weight:208.21 g/mol







