CAS 3198-49-0: Ethyl β-D-glucopyranoside
Description:Ethyl β-D-glucopyranoside is a glycoside derived from glucose, characterized by the presence of an ethyl group attached to the anomeric carbon of the glucose molecule. It is a colorless, viscous liquid that is soluble in water and exhibits sweet taste properties, making it relevant in food and pharmaceutical applications. The compound has a molecular formula that reflects its glycosidic structure, and it typically exists in a stable pyranose form, which is a six-membered ring structure. Ethyl β-D-glucopyranoside is known for its role as a carbohydrate source and can participate in various biochemical reactions, including enzymatic hydrolysis. Its stability and solubility make it useful in various formulations, including those in the cosmetic and food industries. Additionally, it can serve as a building block in organic synthesis, contributing to the development of more complex carbohydrate derivatives. Safety data indicates that it should be handled with care, as with many chemical substances, to avoid potential hazards.
Formula:C8H16O6
InChI:InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8-/m1/s1
InChI key:InChIKey=WYUFTYLVLQZQNH-JAJWTYFOSA-N
SMILES:OCC1OC(OCC)C(O)C(O)C1O
- Synonyms:
- 1-O-Ethyl-b-D-glucopyranoside
- 1-O-Ethyl-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Ethyl <span class="text-smallcaps">D</span>-glucopyranoside
- Ethyl D-glucopyranoside
- Ethyl b-D-glucopyranoside
- Ethyl β-<span class="text-smallcaps">D</span>-glucopyranoside
- Glucopyranoside, ethyl, b-D-
- Glucopyranoside, ethyl, β-<span class="text-smallcaps">D</span>-
- Glucopyranoside,ethyl
- Sucraph AG 6202
- See more synonyms
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, ethyl
- β-D-Glucopyranoside, ethyl
