CAS 31982-77-1
:N-hydroxy-L-isoleucinamide
Description:
N-hydroxy-L-isoleucinamide is a chemical compound characterized by its structural features, which include a hydroxyl group attached to the nitrogen of the isoleucinamide moiety. This compound is part of the broader class of amino acid derivatives and is notable for its potential applications in biochemical research and pharmaceutical development. It typically exhibits properties such as solubility in polar solvents, which is common for compounds containing hydroxyl groups. The presence of the N-hydroxy functional group may impart unique reactivity, making it a candidate for various chemical reactions, including those involving nitrosation or as a potential intermediate in synthetic pathways. Additionally, its stereochemistry, being derived from L-isoleucine, may influence its biological activity and interactions with enzymes or receptors. As with many amino acid derivatives, N-hydroxy-L-isoleucinamide may also exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of effects and applications.
Formula:C6H14N2O2
InChI:InChI=1/C6H14N2O2/c1-3-4(2)5(7)6(9)8-10/h4-5,10H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NO)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Ile-NHOH acetate salt
CAS:<p>H-Ile-NHOH acetate salt is an inhibitor of l-amino acid metabolism. It is a competitive inhibitor of the enzyme L-amino acid oxidase, which catalyzes the conversion of l-amino acids to alpha-keto acids and ammonia. H-Ile-NHOH acetate salt has been shown to inhibit the growth of wild type C. glutamicum in a molecular modeling study. In addition, this compound has been shown to block messenger RNA (mRNA) synthesis in a mutant strain of C. glutamicum that does not have the frameshifting mutation. H-Ile-NHOH acetate salt is also known to be an inhibitor of fatty acid biosynthesis by blocking the activity of acyl carrier protein synthetase and acyl carrier protein reductase.</p>Formula:C6H14N2O2Purity:Min. 95%Molecular weight:146.19 g/mol
