CAS 31982-78-2

L-leucine hydroxamate

Description:

L-leucine hydroxamate is a derivative of the amino acid leucine, characterized by the presence of a hydroxamate functional group. This compound is typically recognized for its role in biochemical processes, particularly in the context of protein synthesis and metabolism. L-leucine itself is an essential branched-chain amino acid that plays a crucial role in muscle protein synthesis and energy production. The hydroxamate group, which consists of a carbonyl group bonded to a hydroxylamine, can enhance the compound's ability to interact with metal ions and enzymes, potentially influencing various biological activities. L-leucine hydroxamate may exhibit properties such as solubility in polar solvents and stability under physiological conditions, making it of interest in both nutritional and pharmaceutical applications. Its potential as a modulator of metabolic pathways and its implications in therapeutic contexts are areas of ongoing research. Overall, L-leucine hydroxamate represents a unique intersection of amino acid biochemistry and functional group chemistry, contributing to its significance in various scientific fields.

Formula: C₆H₁₄N₂O₂

InChI: InChI=1/C6H14N2O2/c1-4(2)3-5(7)6(9)8-10/h4-5,10H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1

SMILES: CC(C)C[C@@H](C(=NO)O)N

Synonyms:

• H-Leu-NHOH . acetate
• N-hydroxy-L-leucinamide

H-Leu-NHOH·TFA

CAS: 31982-78-2

H-Leu-NHOH·TFA is a histidine analogue that is used as a catalyst. It has been shown to be an effective inhibitor of corynebacteria, and can be used in the synthesis of fatty acids, which are important for cell membrane production. H-Leu-NHOH·TFA also binds to the enzyme synthetase and inhibits its activity, which blocks the conversion of ammonia and amino acids into polypeptides. This inhibition prevents bacterial growth. H-Leu-NHOH·TFA is active at acidic pH levels, with a maximum activity at pH 4.0. The optimum temperature for this compound is 50°C, but it will still work at temperatures up to 60°C.

Formula: C₆H₁₄N₂O₂·C₂HF₃O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 260.21 g/mol

Ref: 3D-FL107856