CAS 31984-10-8

1-bromo-4-phenylbutan-2-one

Description:

1-Bromo-4-phenylbutan-2-one, with the CAS number 31984-10-8, is an organic compound characterized by its structure, which includes a bromine atom, a phenyl group, and a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The ketone group contributes to its potential as a precursor in organic synthesis, particularly in the formation of various derivatives through reactions such as reduction or condensation. Additionally, the phenyl group enhances its aromatic characteristics, which may influence its solubility and interaction with other chemical species. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 1-bromo-4-phenylbutan-2-one serves as a valuable intermediate in synthetic organic chemistry.

Formula: C₁₀H₁₁BrO

InChI: InChI=1/C10H11BrO/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2

SMILES: c1ccc(cc1)CCC(=O)CBr

Synonyms:

• 2-Butanone, 1-Bromo-4-Phenyl-

1-Bromo-4-phenylbutan-2-one

CAS: 31984-10-8

Formula: C₁₀H₁₁BrO

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.0977

Ref: IN-DA003E55

1-Bromo-4-phenylbutan-2-one

CAS: 31984-10-8

1-Bromo-4-phenylbutan-2-one

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.10g/mol

Ref: 54-OR939073

1-Bromo-4-phenylbutan-2-one

CAS: 31984-10-8

Formula: C₁₀H₁₁BrO

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.101

Ref: 10-F216411