CAS 319906-45-1
:2-Bromo-7-iodo-9,9-dimethylfluorene
Description:
2-Bromo-7-iodo-9,9-dimethylfluorene is an organic compound characterized by its unique structure, which includes a fluorene backbone substituted with bromine and iodine atoms. The presence of these halogens introduces significant reactivity and influences the compound's physical and chemical properties. Typically, compounds like this exhibit moderate solubility in organic solvents due to their hydrophobic nature, while their reactivity can be attributed to the electrophilic nature of the halogen substituents. The dimethyl groups enhance steric hindrance, which can affect the compound's reactivity and stability. Additionally, the compound may exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics or as a fluorescent probe. Its synthesis often involves halogenation reactions and careful handling due to the reactivity of the halogen substituents. Overall, 2-Bromo-7-iodo-9,9-dimethylfluorene represents a complex molecule with diverse potential applications in materials science and organic synthesis.
Formula:C15H12BrI
InChI:InChI=1/C15H12BrI/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-8H,1-2H3
SMILES:CC1(C)c2cc(ccc2c2ccc(cc12)I)Br
Synonyms:- 2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
- 7-Bromo-2-Iodo-9,9-Dimethyl-9H-Fluorene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Bromo-2-iodo-9,9-dimethyl-9H-fluorene
CAS:Formula:C15H12BrIPurity:97%Color and Shape:SolidMolecular weight:399.06432-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
CAS:2-Bromo-7-iodo-9,9-dimethyl-9H-fluorenePurity:99%Molecular weight:399.07g/mol2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene
CAS:2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene is a chemical compound that is used as a sensor for electron transfer in organic molecules. When the molecule is oxidized, the bromine atom is reduced to hydrogen bromide, which is able to conduct electricity. This allows it to be used as a sensing electrode to measure electron transfer in organic molecules. 2-Bromo-7-iodo-9,9-dimethyl-9H-fluorene has been synthesized using experimental techniques and geometry experiments. The transport of electrons can be measured using electrodes with tripodal geometry with nanoscale dimensions.Formula:C15H12BrIPurity:95%NmrMolecular weight:399.06 g/mol



