CAS 31991-54-5

4,4',5,5'-tetrahydroxy-9,9'-bianthracene-10,10'(9H,9'H)-dione

Description:

4,4',5,5'-Tetrahydroxy-9,9'-bianthracene-10,10'(9H,9'H)-dione, with CAS number 31991-54-5, is a polycyclic aromatic compound characterized by its complex structure, which includes two anthracene units linked by a dione functional group and multiple hydroxyl groups. This compound exhibits notable properties such as strong fluorescence and potential applications in organic electronics and photonics due to its ability to absorb and emit light. The presence of hydroxyl groups contributes to its solubility in polar solvents and enhances its reactivity, making it suitable for various chemical modifications. Additionally, the bianthracene structure may impart interesting electronic properties, which can be exploited in the development of organic semiconductors. Its stability and reactivity can be influenced by the surrounding environment, including pH and solvent polarity. Overall, this compound represents a significant interest in materials science and organic chemistry for its unique structural features and potential applications in advanced technologies.

Formula: C₂₈H₁₈O₆

InChI: InChI=1/C28H18O6/c29-17-9-1-5-13-21(14-6-2-10-18(30)24(14)27(33)23(13)17)22-15-7-3-11-19(31)25(15)28(34)26-16(22)8-4-12-20(26)32/h1-12,21-22,29-32H

SMILES: c1cc2C(c3cccc(c3C(=O)c2c(c1)O)O)C1c2cccc(c2C(=O)c2c1cccc2O)O

Synonyms:

• (9,9'-Bianthracene)-10,10'(9H,9'H)-dione, 4,4',5,5'-tetrahydroxy-

Dithranol dimer

CAS: 31991-54-5

Dithranol dimer

Color and Shape: Yellow

Ref: 47-386

Dithranol EP Impurity C

Controlled Product

CAS: 31991-54-5

Formula: C₂₈H₁₈O₆

Color and Shape: Neat

Molecular weight: 450.44

Ref: 86-MM0137.02

Anthralin dimer

Controlled Product

CAS: 31991-54-5

Formula: C₂₈H₁₈O₆

Color and Shape: Neat

Molecular weight: 450.44

Ref: TR-A420020

Dithranol EP Impurity C

CAS: 31991-54-5

Formula: C₂₈H₁₈O₆

Molecular weight: 450.4

Ref: ST-EA-CP-D171003