CAS 320-72-9
:3,5-Dichlorosalicylic acid
Description:
3,5-Dichlorosalicylic acid is an organic compound characterized by its aromatic structure, which includes a salicylic acid backbone with two chlorine substituents at the 3 and 5 positions on the benzene ring. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and higher solubility in organic solvents such as ethanol and acetone. It possesses both acidic and phenolic functional groups, contributing to its reactivity and potential applications in various chemical reactions. 3,5-Dichlorosalicylic acid is often used in the synthesis of pharmaceuticals, agrochemicals, and as a reagent in biochemical assays. Its chlorinated structure may impart unique properties, such as enhanced biological activity or altered solubility profiles, making it of interest in research and industrial applications. Additionally, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H4Cl2O3
InChI:InChI=1S/C7H4Cl2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,(H,11,12)
InChI key:InChIKey=CNJGWCQEGROXEE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1
Synonyms:- 2-Hydroxy-3,5-dichlorobenzoic acid
- 3,5-Dichloro-2-Hydroxybenzoate
- 3,5-Dichloro-2-Hydroxybenzoic Acid
- 3,5-Dichlorosa licglic acid
- Benzoic Acid, 3,5-Dichloro-2-Hydroxy-
- NSC 30109
- Salicylic acid, 3,5-dichloro-
- 3,5-Dichlorosalicylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-Dichloro-2-hydroxybenzoic acid
CAS:Formula:C7H4Cl2O3Purity:98%Color and Shape:SolidMolecular weight:207.01093,5-Dichlorosalicylic acid
CAS:Formula:C7H4Cl2O3Purity:(GC) ≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:207.013,5-Dichloro-2-hydroxybenzoic acid
CAS:3,5-Dichloro-2-hydroxybenzoic acidFormula:C7H4Cl2O3Purity:98%Color and Shape: white crystalline solidMolecular weight:207.01g/mol3,5-Dichlorosalicylic Acid
CAS:Formula:C7H4Cl2O3Purity:>97.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:207.013,5-Dichlorosalicylic acid
CAS:3,5-Dichlorosalicylic acid is a proton donor that is used to inhibit the 5-nitrosalicylic acid chain reaction. It has a high binding constant with the chlorine atom and can be used as a competitive inhibitor for the binding of 5-nitrosalicylic acid to its target enzyme. 3,5-Dichlorosalicylic acid inhibits the polymerase chain reaction by binding to DNA. This chemical also has biological properties that are similar to those of salicylic acid, including anti-inflammatory activities. 3,5-Dichlorosalicylic acid is not an effective anti-cancer agent because it does not form intramolecular hydrogen bonds or hydrogen bond interactions with DNA bases.Formula:C7H4Cl2O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:207.01 g/mol3,5-Dichloro-2-hydroxybenzoic acid
CAS:Formula:C7H4Cl2O3Purity:98%Color and Shape:SolidMolecular weight:207.01





