CAS 320-88-7
:2,5-bis(trifluoromethyl)nitrobenzene
Description:
2,5-Bis(trifluoromethyl)nitrobenzene is an aromatic compound characterized by the presence of two trifluoromethyl groups and one nitro group attached to a benzene ring. Its molecular structure features a benzene core with substituents at the 2 and 5 positions, which significantly influence its chemical properties. This compound is typically a solid at room temperature and exhibits a high degree of stability due to the strong electron-withdrawing effects of the trifluoromethyl groups. These substituents enhance the compound's reactivity, particularly in electrophilic aromatic substitution reactions. The nitro group contributes to its potential as an electron-deficient aromatic compound, making it useful in various chemical syntheses and applications, including as a precursor in the production of agrochemicals and pharmaceuticals. Additionally, the presence of multiple fluorine atoms imparts unique physical properties, such as increased lipophilicity and thermal stability. However, handling this compound requires caution due to its potential toxicity and environmental impact.
Formula:C8H3F6NO2
InChI:InChI=1S/C8H3F6NO2/c9-7(10,11)4-1-2-5(8(12,13)14)6(3-4)15(16)17/h1-3H
InChI key:BZKVUOHHNCMTLH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])C(F)(F)F
Synonyms:- 2-Nitro-1,4-bis(trifluoromethyl)benzene
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Nitro-2,5-bis(trifluoromethyl)benzene
CAS:Formula:C8H3F6NO2Purity:>98.0%(GC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:259.112-Nitro-1,4-bis(trifluoromethyl)benzene
CAS:Formula:C8H3F6NO2Purity:97%Color and Shape:LiquidMolecular weight:259.10532,5-Bis(trifluoromethyl)nitrobenzene
CAS:2,5-Bis(trifluoromethyl)nitrobenzeneFormula:C8H3F6NO2Purity:97%Color and Shape:LiquidMolecular weight:259.105332,5-Bis(trifluoromethyl)nitrobenzene
CAS:Formula:C8H3F6NO2Purity:97%Color and Shape:LiquidMolecular weight:259.1072-Nitro-1,4-bis(trifluoromethyl)benzene
CAS:2-Nitro-1,4-bis(trifluoromethyl)benzeneFormula:C8H3F6NO2Purity:97%Molecular weight:259.112,5-Bis(Trifluoromethyl)nitrobenzene
CAS:Controlled ProductApplications 2,5-Bis(Trifluoromethyl)Nitrobenzene (cas# 320-88-7) is a useful research chemical.
Formula:C8H3NO2F6Color and Shape:NeatMolecular weight:259.112,5-Bis(Trifluoromethyl)nitrobenzene-13C6
CAS:Controlled ProductApplications 2,5-Bis(Trifluoromethyl)nitrobenzene-13C6 is an intermediate in the synthesis of Dutasteride-13C6 (D735002), which is a labeled Dutasteride (D735000). Dutasteride is a dual inhibitor of 5α-reductase isoenzymes type 1 and 2; structurally related to Finasteride (F342000). Dutasteride is used in the treatment of benign prostatic hyperplasia.
References Bakshi, R.K., et al.: J. Med. Chem., 38, 3189 (1995), Gisleskog, P.O., et al.: Brit. J. Clin. Pharmacol., 47, 53 (1999), Djavan, B., et al.: Expert Opin. Pharmacother., 6, 311 (2005),Formula:C6C2H3F6NO2Color and Shape:NeatMolecular weight:265.061






