CymitQuimica logo

CAS 32003-41-1

:

4-(2,3-dichlorophenyl)-4-oxo-butanoic acid

Description:
4-(2,3-Dichlorophenyl)-4-oxo-butanoic acid, with the CAS number 32003-41-1, is an organic compound characterized by its unique structure, which includes a butanoic acid backbone substituted with a 2,3-dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including potential acidity due to the carboxylic acid functional group. The presence of the dichlorophenyl moiety may impart specific reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting the influence of its hydrophobic aromatic component. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C10H8Cl2O3
InChI:InChI=1/C10H8Cl2O3/c11-7-3-1-2-6(10(7)12)8(13)4-5-9(14)15/h1-3H,4-5H2,(H,14,15)
SMILES:c1cc(C(=O)CCC(=O)O)c(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.